Benzene and substituted derivatives
Filtered Search Results
Benzophenone-4, Spectrum™ Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 4065-45-6
| CAS | 4065-45-6 |
|---|
Fluconazole, Research Grade, Spectrum™ Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 86386-73-4
| CAS | 86386-73-4 |
|---|
1,1-Diphenylethylene oxide
CAS: 882-59-7 Molecular Formula: C14H12O Molecular Weight (g/mol): 196.25 MDL Number: MFCD00040725 InChI Key: PRLJMHVNHLTQJJ-UHFFFAOYSA-N Synonym: 1,1-diphenylethylene oxide,oxirane, 2,2-diphenyl,diphenyloxirane,2,2-diphenyl-oxirane,2,2-diphenyl oxirane,#,1,1-diphenyl-ethylenoxide,1,1-diphenyl-ethylene oxide,1,1-diphenyl-1,2-epoxyethane PubChem CID: 93564 IUPAC Name: 2,2-diphenyloxirane SMILES: C1C(O1)(C2=CC=CC=C2)C3=CC=CC=C3
| PubChem CID | 93564 |
|---|---|
| CAS | 882-59-7 |
| Molecular Weight (g/mol) | 196.25 |
| MDL Number | MFCD00040725 |
| SMILES | C1C(O1)(C2=CC=CC=C2)C3=CC=CC=C3 |
| Synonym | 1,1-diphenylethylene oxide,oxirane, 2,2-diphenyl,diphenyloxirane,2,2-diphenyl-oxirane,2,2-diphenyl oxirane,#,1,1-diphenyl-ethylenoxide,1,1-diphenyl-ethylene oxide,1,1-diphenyl-1,2-epoxyethane |
| IUPAC Name | 2,2-diphenyloxirane |
| InChI Key | PRLJMHVNHLTQJJ-UHFFFAOYSA-N |
| Molecular Formula | C14H12O |
4-(Boc-aminomethyl)-3-fluorobenzeneboronic acid pinacol ester, 96%, Thermo Scientific Chemicals
CAS: 1351501-44-4 Molecular Formula: C18H27BFNO4 Molecular Weight (g/mol): 351.225 InChI Key: SAUVAJYHMCIQNE-UHFFFAOYSA-N Synonym: 4-(Boc-aminomethyl)-3-fluorophenylboronic acid pinacol ester PubChem CID: 66980292 IUPAC Name: tert-butyl N-[[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]carbamate SMILES: B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)CNC(=O)OC(C)(C)C)F
| PubChem CID | 66980292 |
|---|---|
| CAS | 1351501-44-4 |
| Molecular Weight (g/mol) | 351.225 |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)CNC(=O)OC(C)(C)C)F |
| Synonym | 4-(Boc-aminomethyl)-3-fluorophenylboronic acid pinacol ester |
| IUPAC Name | tert-butyl N-[[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]carbamate |
| InChI Key | SAUVAJYHMCIQNE-UHFFFAOYSA-N |
| Molecular Formula | C18H27BFNO4 |
4-Fluoro-2-iodoaniline, 96%
CAS: 61272-76-2 Molecular Formula: C6H5FIN Molecular Weight (g/mol): 237.02 MDL Number: MFCD00042584 InChI Key: SETOTRGVPANENO-UHFFFAOYSA-N Synonym: 2-iodo-4-fluoroaniline,4-fluoro-2-indoaniline,4-fluoro-2-iodoanline,4-fluoro-2-iodo-aniline,4-fluoro-2-iodophenylamine,4-fluoro-2-iodo-phenylamine,benzenamine, 4-fluoro-2-iodo,zlchem 368,pubchem3413,2-iodo-4-fluoro-aniline PubChem CID: 2778283 IUPAC Name: 4-fluoro-2-iodoaniline SMILES: NC1=C(I)C=C(F)C=C1
| PubChem CID | 2778283 |
|---|---|
| CAS | 61272-76-2 |
| Molecular Weight (g/mol) | 237.02 |
| MDL Number | MFCD00042584 |
| SMILES | NC1=C(I)C=C(F)C=C1 |
| Synonym | 2-iodo-4-fluoroaniline,4-fluoro-2-indoaniline,4-fluoro-2-iodoanline,4-fluoro-2-iodo-aniline,4-fluoro-2-iodophenylamine,4-fluoro-2-iodo-phenylamine,benzenamine, 4-fluoro-2-iodo,zlchem 368,pubchem3413,2-iodo-4-fluoro-aniline |
| IUPAC Name | 4-fluoro-2-iodoaniline |
| InChI Key | SETOTRGVPANENO-UHFFFAOYSA-N |
| Molecular Formula | C6H5FIN |
alpha,alpha-Dimethylphenylacetic acid
CAS: 826-55-1 Molecular Formula: C10H12O2 Molecular Weight (g/mol): 164.20 MDL Number: MFCD00014332 InChI Key: YYEROYLAYAVZNW-UHFFFAOYSA-N Synonym: 2-methyl-2-phenylpropionic acid,2-phenylisobutyric acid,alpha,alpha-dimethylphenylacetic acid,unii-dr8huh2gyk,dimethylphenylacetic acid,dr8huh2gyk,2-methyl-2-phenyl-propionic acid,hydratropic acid, .alpha.-methyl,benzeneacetic acid,.alpha.-dimethyl,propionic acid, 2-methyl-2-phenyl PubChem CID: 13222 IUPAC Name: 2-methyl-2-phenylpropanoic acid SMILES: CC(C)(C(O)=O)C1=CC=CC=C1
| PubChem CID | 13222 |
|---|---|
| CAS | 826-55-1 |
| Molecular Weight (g/mol) | 164.20 |
| MDL Number | MFCD00014332 |
| SMILES | CC(C)(C(O)=O)C1=CC=CC=C1 |
| Synonym | 2-methyl-2-phenylpropionic acid,2-phenylisobutyric acid,alpha,alpha-dimethylphenylacetic acid,unii-dr8huh2gyk,dimethylphenylacetic acid,dr8huh2gyk,2-methyl-2-phenyl-propionic acid,hydratropic acid, .alpha.-methyl,benzeneacetic acid,.alpha.-dimethyl,propionic acid, 2-methyl-2-phenyl |
| IUPAC Name | 2-methyl-2-phenylpropanoic acid |
| InChI Key | YYEROYLAYAVZNW-UHFFFAOYSA-N |
| Molecular Formula | C10H12O2 |
2,4-Dibromo-1-fluorobenzene, 98%, Thermo Scientific™
CAS: 1435-53-6 Molecular Formula: C6H3Br2F Molecular Weight (g/mol): 253.90 MDL Number: MFCD00000283 InChI Key: MKHDDTWHDFVYDQ-UHFFFAOYSA-N Synonym: 2,4-dibromofluorobenzene,1,3-dibromo-4-fluorobenzene,1-fluoro-2,4-dibromobenzene,benzene, 2,4-dibromo-1-fluoro,pubchem3446,acmc-209cqz,1,3-dibromo-5-fluoro,intermediates-zcf02097,ksc494g9j PubChem CID: 15034 IUPAC Name: 2,4-dibromo-1-fluorobenzene SMILES: FC1=CC=C(Br)C=C1Br
| PubChem CID | 15034 |
|---|---|
| CAS | 1435-53-6 |
| Molecular Weight (g/mol) | 253.90 |
| MDL Number | MFCD00000283 |
| SMILES | FC1=CC=C(Br)C=C1Br |
| Synonym | 2,4-dibromofluorobenzene,1,3-dibromo-4-fluorobenzene,1-fluoro-2,4-dibromobenzene,benzene, 2,4-dibromo-1-fluoro,pubchem3446,acmc-209cqz,1,3-dibromo-5-fluoro,intermediates-zcf02097,ksc494g9j |
| IUPAC Name | 2,4-dibromo-1-fluorobenzene |
| InChI Key | MKHDDTWHDFVYDQ-UHFFFAOYSA-N |
| Molecular Formula | C6H3Br2F |
3-Phenoxybenzyl alcohol, 98%
CAS: 13826-35-2 Molecular Formula: C13H12O2 Molecular Weight (g/mol): 200.24 MDL Number: MFCD00004636 InChI Key: KGANAERDZBAECK-UHFFFAOYSA-N Synonym: 3-phenoxybenzyl alcohol,3-phenoxyphenyl methanol,3-phenoxybenzylalcohol,m-phenoxybenzyl alcohol,3-phenoxybenzenemethanol,benzenemethanol, 3-phenoxy,3-hydroxymethyl diphenyl ether,3-phenoxybenzylic alcohol,benzyl alcohol, m-phenoxy,3-pboh PubChem CID: 26295 ChEBI: CHEBI:62527 IUPAC Name: (3-phenoxyphenyl)methanol SMILES: C1=CC=C(C=C1)OC2=CC=CC(=C2)CO
| PubChem CID | 26295 |
|---|---|
| CAS | 13826-35-2 |
| Molecular Weight (g/mol) | 200.24 |
| ChEBI | CHEBI:62527 |
| MDL Number | MFCD00004636 |
| SMILES | C1=CC=C(C=C1)OC2=CC=CC(=C2)CO |
| Synonym | 3-phenoxybenzyl alcohol,3-phenoxyphenyl methanol,3-phenoxybenzylalcohol,m-phenoxybenzyl alcohol,3-phenoxybenzenemethanol,benzenemethanol, 3-phenoxy,3-hydroxymethyl diphenyl ether,3-phenoxybenzylic alcohol,benzyl alcohol, m-phenoxy,3-pboh |
| IUPAC Name | (3-phenoxyphenyl)methanol |
| InChI Key | KGANAERDZBAECK-UHFFFAOYSA-N |
| Molecular Formula | C13H12O2 |
4-Iodobenzeneboronic acid, 97%
CAS: 5122-99-6 Molecular Formula: C6H6BIO2 Molecular Weight (g/mol): 247.83 MDL Number: MFCD01319014 InChI Key: PELJYVULHLKXFF-UHFFFAOYSA-N Synonym: 4-iodophenyl boronic acid,4-iodobenzeneboronic acid,p-iodophenylboronic acid,4-iodophenylboronicacid,p-iodobenzeneboronic acid,p-iodophenyl boronic acid,boronic acid, 4-iodophenyl,4-boronoiodobenzene,pubchem6160,pubchem11574 PubChem CID: 151254 IUPAC Name: (4-iodophenyl)boronic acid SMILES: OB(O)C1=CC=C(I)C=C1
| PubChem CID | 151254 |
|---|---|
| CAS | 5122-99-6 |
| Molecular Weight (g/mol) | 247.83 |
| MDL Number | MFCD01319014 |
| SMILES | OB(O)C1=CC=C(I)C=C1 |
| Synonym | 4-iodophenyl boronic acid,4-iodobenzeneboronic acid,p-iodophenylboronic acid,4-iodophenylboronicacid,p-iodobenzeneboronic acid,p-iodophenyl boronic acid,boronic acid, 4-iodophenyl,4-boronoiodobenzene,pubchem6160,pubchem11574 |
| IUPAC Name | (4-iodophenyl)boronic acid |
| InChI Key | PELJYVULHLKXFF-UHFFFAOYSA-N |
| Molecular Formula | C6H6BIO2 |
N-Benzylaminoacetaldehyde diethyl acetal, 96%
CAS: 61190-10-1 Molecular Formula: C13H21NO2 Molecular Weight (g/mol): 223.316 MDL Number: MFCD00051599 InChI Key: SXFVQTYQHWRYOS-UHFFFAOYSA-N Synonym: n-benzylaminoacetaldehyde diethyl acetal,benzyl 2,2-diethoxyethyl amine,n-benzyl-n-2,2-diethoxyethyl amine,2,2-diethoxyethyl benzylamine,acmc-20ak6r,benzylaminoacetaldehyde diethylacetal,benzyl-2,2-diethoxy-ethyl-amine,benzylamino-acetaldehyde diethyl acetal,n-benzyl 2-aminoacetaldehyde diethyl acetal PubChem CID: 521961 IUPAC Name: N-benzyl-2,2-diethoxyethanamine SMILES: CCOC(CNCC1=CC=CC=C1)OCC
| PubChem CID | 521961 |
|---|---|
| CAS | 61190-10-1 |
| Molecular Weight (g/mol) | 223.316 |
| MDL Number | MFCD00051599 |
| SMILES | CCOC(CNCC1=CC=CC=C1)OCC |
| Synonym | n-benzylaminoacetaldehyde diethyl acetal,benzyl 2,2-diethoxyethyl amine,n-benzyl-n-2,2-diethoxyethyl amine,2,2-diethoxyethyl benzylamine,acmc-20ak6r,benzylaminoacetaldehyde diethylacetal,benzyl-2,2-diethoxy-ethyl-amine,benzylamino-acetaldehyde diethyl acetal,n-benzyl 2-aminoacetaldehyde diethyl acetal |
| IUPAC Name | N-benzyl-2,2-diethoxyethanamine |
| InChI Key | SXFVQTYQHWRYOS-UHFFFAOYSA-N |
| Molecular Formula | C13H21NO2 |
3-(Phenoxymethyl)benzoic acid, 97%, Thermo Scientific™
CAS: 31719-75-2 Molecular Formula: C14H12O3 Molecular Weight (g/mol): 228.247 InChI Key: URLYREZIPSJJQU-UHFFFAOYSA-N Synonym: 3-phenoxymethyl benzoic acid,benzoic acid,3-phenoxymethyl,4rg PubChem CID: 3729884 IUPAC Name: 3-(phenoxymethyl)benzoic acid SMILES: C1=CC=C(C=C1)OCC2=CC=CC(=C2)C(=O)O
| PubChem CID | 3729884 |
|---|---|
| CAS | 31719-75-2 |
| Molecular Weight (g/mol) | 228.247 |
| SMILES | C1=CC=C(C=C1)OCC2=CC=CC(=C2)C(=O)O |
| Synonym | 3-phenoxymethyl benzoic acid,benzoic acid,3-phenoxymethyl,4rg |
| IUPAC Name | 3-(phenoxymethyl)benzoic acid |
| InChI Key | URLYREZIPSJJQU-UHFFFAOYSA-N |
| Molecular Formula | C14H12O3 |
4-(Bromomethyl)benzaldehyde, 97%, Thermo Scientific™
CAS: 51359-78-5 Molecular Formula: C8H7BrO Molecular Weight (g/mol): 199.047 InChI Key: XYPVBKDHERGKJG-UHFFFAOYSA-N PubChem CID: 11206421 IUPAC Name: 4-(bromomethyl)benzaldehyde SMILES: C1=CC(=CC=C1CBr)C=O
| PubChem CID | 11206421 |
|---|---|
| CAS | 51359-78-5 |
| Molecular Weight (g/mol) | 199.047 |
| SMILES | C1=CC(=CC=C1CBr)C=O |
| IUPAC Name | 4-(bromomethyl)benzaldehyde |
| InChI Key | XYPVBKDHERGKJG-UHFFFAOYSA-N |
| Molecular Formula | C8H7BrO |
2,6-Dibromo-4-(trifluoromethyl)aniline, 97%
CAS: 72678-19-4 Molecular Formula: C7H4Br2F3N Molecular Weight (g/mol): 318.919 MDL Number: MFCD00068181 InChI Key: DRSMEHXBOXHXDX-UHFFFAOYSA-N Synonym: 2,6-dibromo-4-trifluoromethyl aniline,4-amino-3,5-dibromobenzotrifluoride,2,6-dibromo-4-trifluoromethyl phenylamine,benzenamine,2,6-dibromo-4-trifluoromethyl,benzenamine, 2,6-dibromo-4-trifluoromethyl,pubchem2805,acmc-209ony,buttpark 29\06-99,2,6-dibromo-4-trifluoromethyl-phenylamine PubChem CID: 144565 IUPAC Name: 2,6-dibromo-4-(trifluoromethyl)aniline SMILES: C1=C(C=C(C(=C1Br)N)Br)C(F)(F)F
| PubChem CID | 144565 |
|---|---|
| CAS | 72678-19-4 |
| Molecular Weight (g/mol) | 318.919 |
| MDL Number | MFCD00068181 |
| SMILES | C1=C(C=C(C(=C1Br)N)Br)C(F)(F)F |
| Synonym | 2,6-dibromo-4-trifluoromethyl aniline,4-amino-3,5-dibromobenzotrifluoride,2,6-dibromo-4-trifluoromethyl phenylamine,benzenamine,2,6-dibromo-4-trifluoromethyl,benzenamine, 2,6-dibromo-4-trifluoromethyl,pubchem2805,acmc-209ony,buttpark 29\06-99,2,6-dibromo-4-trifluoromethyl-phenylamine |
| IUPAC Name | 2,6-dibromo-4-(trifluoromethyl)aniline |
| InChI Key | DRSMEHXBOXHXDX-UHFFFAOYSA-N |
| Molecular Formula | C7H4Br2F3N |
Tetrakis(triphenylphosphine)palladium(0), 99.9%, (trace metal basis)
CAS: 14221-01-3 Molecular Formula: C72H60P4Pd Molecular Weight (g/mol): 1155.59 MDL Number: MFCD00010012 InChI Key: NFHFRUOZVGFOOS-UHFFFAOYSA-N Synonym: tetrakis triphenylphosphine palladium,tetrakis triphenylphosphine palladium 0,pd pph3 4,tetrakis triphenylphosphine palladium o,tetra triphenylphosphine palladium,palladium-tetrakis triphenylphosphine,palladium 0 tetrakis triphenylphosphine,palladium, tetrakis triphenylphosphine-, t-4 PubChem CID: 11979704 IUPAC Name: palladium;triphenylphosphane SMILES: [Pd].C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 11979704 |
|---|---|
| CAS | 14221-01-3 |
| Molecular Weight (g/mol) | 1155.59 |
| MDL Number | MFCD00010012 |
| SMILES | [Pd].C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1.C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | tetrakis triphenylphosphine palladium,tetrakis triphenylphosphine palladium 0,pd pph3 4,tetrakis triphenylphosphine palladium o,tetra triphenylphosphine palladium,palladium-tetrakis triphenylphosphine,palladium 0 tetrakis triphenylphosphine,palladium, tetrakis triphenylphosphine-, t-4 |
| IUPAC Name | palladium;triphenylphosphane |
| InChI Key | NFHFRUOZVGFOOS-UHFFFAOYSA-N |
| Molecular Formula | C72H60P4Pd |
Methyl 3-nitrobenzoate, 98+%
CAS: 618-95-1 Molecular Formula: C8H7NO4 Molecular Weight (g/mol): 181.147 MDL Number: MFCD00007250 InChI Key: AXLYJLKKPUICKV-UHFFFAOYSA-N Synonym: 3-nitrobenzoic acid methyl ester,methyl m-nitrobenzoate,methyl3-nitrobenzoate,benzoic acid, 3-nitro-, methyl ester,m-nitrobenzoic acid, methyl ester,benzoic acid, m-nitro-, methyl ester,3-nitro-benzoic acid methyl ester,3-nitro-benzoicacimethylester,acmc-209mxc,methyl 3-nitro-benzoate PubChem CID: 69260 IUPAC Name: methyl 3-nitrobenzoate SMILES: COC(=O)C1=CC(=CC=C1)[N+](=O)[O-]
| PubChem CID | 69260 |
|---|---|
| CAS | 618-95-1 |
| Molecular Weight (g/mol) | 181.147 |
| MDL Number | MFCD00007250 |
| SMILES | COC(=O)C1=CC(=CC=C1)[N+](=O)[O-] |
| Synonym | 3-nitrobenzoic acid methyl ester,methyl m-nitrobenzoate,methyl3-nitrobenzoate,benzoic acid, 3-nitro-, methyl ester,m-nitrobenzoic acid, methyl ester,benzoic acid, m-nitro-, methyl ester,3-nitro-benzoic acid methyl ester,3-nitro-benzoicacimethylester,acmc-209mxc,methyl 3-nitro-benzoate |
| IUPAC Name | methyl 3-nitrobenzoate |
| InChI Key | AXLYJLKKPUICKV-UHFFFAOYSA-N |
| Molecular Formula | C8H7NO4 |